Addition Of Br2 To Buta

     

Cho buta-1,3-đien phản ứng cộng với Br2 theo tỉ lệ mol 1:1. Số dẫn xuất đibrom (đồng phân cấu tạo và đồng phân hình học) thu được là:




Bạn đang xem: Addition of br2 to buta

$C{H_2} = CH - CH = C{H_2} + {\text{ }}B{r_2}\xrightarrow{{1:\,\,1}}\left< \begin{gathered}C{H_2}Br - CHBr - CH = C{H_2}\,\,\,\,\,\,\,\,\,\,\,\,\,\,\,\,\,\,\,\,\,(1) \hfill \\C{H_2}Br - CH = CH - C{H_2}Br\,\,\,\,\,c{\text{is}}\,\,\,\,\,\,\,\,\,(2) \hfill \\C{H_2}Br - CH = CH - C{H_2}Br\,\,\,\,\,trans\,\,(3) \hfill \\ \end{gathered} \right.$


*
*
*
*
*
*
*
*

Cho các chất sau: 2-metylbut-1-en (1); 3,3-đimetylbut-1-en (2); 3-metylpent-1-en (3); 3-metylpent-2-en (4). Những chất nào là đồng phân của nhau ?


Cho các chất sau: CH2=CHCH2CH2CH=CH2; CH2=CHCH=CHCH2CH3; CH3C(CH3)=CHCH2; CH2=CHCH2CH=CH2; CH3CH2CH=CHCH2CH3; CH3C(CH3)=CHCH2CH3; CH3CH2C(CH3)=C(C2H5)CH(CH3)2; CH3CH=CHCH3.

Số chất có đồng phân hình học là:


Anken C4H8 có bao nhiêu đồng phân khi tác dụng với dung dịch HCl chỉ cho một sản phẩm hữu cơ duy nhất ?


Ba hiđrocacbon X, Y, Z kế tiếp nhau trong dãy đồng đẳng, trong đó khối lượng phân tử Z gấp đôi khối lượng phân tử X. Đốt cháy 0,1 mol chất Y, sản phẩm khí hấp thụ hoàn toàn vào dung dịch Ca(OH)2 dư, thu được số gam kết tủa là:


Cho hiđrocacbon X phản ứng với brom (trong dung dịch) theo tỉ lệ mol 1 : 1, thu được chất hữu cơ Y (chứa 74,08% Br về khối lượng). Khi X phản ứng với HBr thì thu được hai sản phẩm hữu cơ khác nhau. Tên gọi của X là:


Để khử hoàn toàn 200 ml dung dịch KMnO4 0,2M tạo thành chất rắn màu nâu đen cần V lít khí C2H4 (ở đktc). Giá trị tối thiểu của V là:


Hỗn hợp khí X gồm H2 và C2H4 có tỉ khối so với He là 3,75. Dẫn X qua Ni nung nóng, thu được hỗn hợp khí Y có tỉ khối so với He là 5. Hiệu suất của phản ứng hiđro hoá là:


Cho buta-1,3-đien phản ứng cộng với Br2 theo tỉ lệ mol 1:1. Số dẫn xuất đibrom (đồng phân cấu tạo và đồng phân hình học) thu được là:


Cho 3,12 gam ankin X phản ứng với 0,1 mol H2 (xúc tác Pd/PbCO3, to), thu được hỗn hợp Y chỉ chứa hai hiđrocacbon. Công thức phân tử của X là:




Xem thêm: Mumps Are A Very Common Disease Which Usually Affects Children

Cho 3,36 lít khí hiđrocacbon X (đktc) phản ứng hoàn toàn với lượng dư dung dịch AgNO3 trong NH3, thu được 36 gam kết tủa. Công thức phân tử của X là:


Đốt cháy hoàn toàn 6,72 lít (đktc) hỗn hợp gồm hai hiđrocacbon X và Y (MY > MX), thu được 11,2 lít khí CO2 (đktc) và 10,8 gam H2O. Công thức của X là:


Đốt cháy hoàn toàn hỗn hợp M gồm một ankan X và một ankin Y, thu được số mol CO2 bằng số mol H2O. Thành phần phần trăm về số mol của X và Y trong hỗn hợp M lần lượt là:


Đốt cháy hoàn toàn 0,2 mol hỗn hợp X gồm một ankan và một anken, thu được 0,35 mol CO2 và 0,4 mol H2O. Phần trăm số mol của anken trong X là:


Đốt cháy hoàn toàn 1 lít hỗn hợp khí gồm C2H2 và hiđrocacbon X sinh ra 2 lít khí CO2 và 2 lít hơi H2O (các thể tích khí và hơi đo ở cùng điều kiện nhiệt độ, áp suất). Công thức phân tử của X là:


Dẫn 1,68 lít hỗn hợp khí X gồm hai hiđrocacbon vào bình đựng dung dịch brom (dư). Sau khi phản ứng xảy ra hoàn toàn, có 4 gam brom đã phản ứng và còn lại 1,12 lít khí. Nếu đốt cháy hoàn toàn 1,68 lít X thì sinh ra 2,8 lít khí CO2. Biết các thể tích khí đều đo ở đktc. Công thức phân tử của hai hiđrocacbon là:


Hỗn hợp X có tỉ khối so với H2 là 21,2 gồm propan, propen và propin. Khi đốt cháy hoàn toàn 0,1 mol X, tổng khối lượng của CO2 và H2O thu được là:


Cho hỗn hợp X gồm CH4, C2H4 và C2H2. Lấy 8,6 gam X tác dụng hết với dung dịch brom (dư) thì khối lượng brom phản ứng là 48 gam. Mặt khác, nếu cho 13,44 lít (ở đktc) hỗn hợp khí X tác dụng với lượng dư dung dịch AgNO3 trong NH3, thu được 36 gam kết tủa. Phần trăm thể tích của CH4 có trong X là:


Hỗn hợp khí X gồm 0,3 mol H2 và 0,1 mol vinylaxetilen. Nung X một thời gian với xúc tác Ni thu được hỗn hợp khí Y có tỉ khối so với không khí là 1. Nếu cho toàn bộ Y sục từ từ vào dung dịch brom (dư) thì có m gam brom tham gia phản ứng. Giá trị của m là:


Dẫn V lít (ở đktc) hỗn hợp X gồm axetilen và hiđro đi qua ống sứ nung nóng, thu được khí Y. Dẫn Y vào lượng dư AgNO3 (hoặc Ag2O) trong dung dịch NH3 thu được 12 gam kết tủa. Khí đi ra khỏi dung dịch phản ứng vừa đủ với 16 gam brom và còn lại khí Z. Đốt cháy hoàn toàn khí Z thu được 2,24 lít khí CO2 (ở đktc) và 4,5 gam nước. Giá trị của V bằng:


Đun nóng hỗn hợp X gồm 0,06 mol C2H2 và 0,04 mol H2 với xúc tác Ni, sau một thời gian thu được hỗn hợp khí Y. Dẫn toàn bộ hỗn hợp Y lội từ từ qua bình đựng dung dịch brom (dư) thì còn lại 0,448 lít hỗn hợp khí Z (ở đktc) có tỉ khối so với O2 là 0,5. Khối lượng bình dung dịch brom tăng là:




Xem thêm: Typical Đi Với Giới Từ Gì : Định Nghĩa, Ví Dụ Trong Tiếng Anh

Đốt cháy hoàn toàn 0,16 mol hỗn hợp X gồm CH4, C2H2, C2H4 và C3H6, thu được 6,272 lít CO2(đktc) và 6,12 gam H2O. Mặt khác 10,1 gam X phản ứng tối đa với a mol Br2 trong dung dịch. Giá trị của a là


Cho dãy các chất: CH4, C2H2, C2H4, C2H5OH, CH2=CH–COOH, C6H5NH2 (anilin), C6H5OH (phenol), C6H6 (benzen). Số chất trong dãy phản ứng được với nước brom là: